C34H24N4 — CID 144924715
(2E)-4-[4-[6-[4-[(3E)-4-cyano-5-iminopenta-1,3-dien-2-yl]phenyl]naphthalen-2-yl]phenyl]-2-methanimidoylpenta-2,4-dienenitrile (PubChem CID 144924715) has the molecular formula C34H24N4 and a molecular weight of 488.59 g/mol. Its IUPAC name is (2E)-4-[4-[6-[4-[(3E)-4-cyano-5-iminopenta-1,3-dien-2-yl]phenyl]naphthalen-2-yl]phenyl]-2-methanimidoylpenta-2,4-dienenitrile.
| Compound Name | (2E)-4-[4-[6-[4-[(3E)-4-cyano-5-iminopenta-1,3-dien-2-yl]phenyl]naphthalen-2-yl]phenyl]-2-methanimidoylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 144924715 |
| Molecular Formula | C34H24N4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | (2E)-4-[4-[6-[4-[(3E)-4-cyano-5-iminopenta-1,3-dien-2-yl]phenyl]naphthalen-2-yl]phenyl]-2-methanimidoylpenta-2,4-dienenitrile |
| SMILES | [H]/N=C/C(C#N)=C\C(=C)c1ccc(-c2ccc3cc(-c4ccc(C(=C)/C=C(C#N)\C=N\[H])cc4)ccc3c2)cc1 |
| InChI | InChI=1S/C34H24N4/c1-23(15-25(19-35)20-36)27-3-7-29(8-4-27)31-11-13-34-18-32(12-14-33(34)17-31)30-9-5-28(6-10-30)24(2)16-26(21-37)22-38/h3-19,21,35,37H,1-2H2/b25-15+,26-16+,35-19+,37-21+ |
| InChIKey | RKHPNESQKSTYJF-GYZFVKJPSA-N |
| XLogP | 8.40 |
| TPSA | 95.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|