C28H20N2 — CID 144924965
(E)-2-[(Z)-2-aminoethenyl]-4-(4-pyren-2-ylphenyl)but-2-enenitrile (PubChem CID 144924965) has the molecular formula C28H20N2 and a molecular weight of 384.48 g/mol. Its IUPAC name is (E)-2-[(Z)-2-aminoethenyl]-4-(4-pyren-2-ylphenyl)but-2-enenitrile.
| Compound Name | (E)-2-[(Z)-2-aminoethenyl]-4-(4-pyren-2-ylphenyl)but-2-enenitrile |
|---|---|
| PubChem CID | 144924965 |
| Molecular Formula | C28H20N2 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | (E)-2-[(Z)-2-aminoethenyl]-4-(4-pyren-2-ylphenyl)but-2-enenitrile |
| SMILES | N#CC(/C=C\N)=C/Cc1ccc(-c2cc3ccc4cccc5ccc(c2)c3c45)cc1 |
| InChI | InChI=1S/C28H20N2/c29-15-14-20(18-30)5-4-19-6-8-21(9-7-19)26-16-24-12-10-22-2-1-3-23-11-13-25(17-26)28(24)27(22)23/h1-3,5-17H,4,29H2/b15-14-,20-5+ |
| InChIKey | MVXIOLNIAXHHTQ-SIFUUYJBSA-N |
| XLogP | 6.72 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|