C28H20N2O — CID 144925399
(E)-2-[(Z)-2-aminoethenyl]-4-(4-naphtho[2,1-b][1]benzofuran-5-ylphenyl)but-2-enenitrile (PubChem CID 144925399) has the molecular formula C28H20N2O and a molecular weight of 400.48 g/mol. Its IUPAC name is (E)-2-[(Z)-2-aminoethenyl]-4-(4-naphtho[2,1-b][1]benzofuran-5-ylphenyl)but-2-enenitrile.
| Compound Name | (E)-2-[(Z)-2-aminoethenyl]-4-(4-naphtho[2,1-b][1]benzofuran-5-ylphenyl)but-2-enenitrile |
|---|---|
| PubChem CID | 144925399 |
| Molecular Formula | C28H20N2O |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | (E)-2-[(Z)-2-aminoethenyl]-4-(4-naphtho[2,1-b][1]benzofuran-5-ylphenyl)but-2-enenitrile |
| SMILES | N#CC(/C=C\N)=C/Cc1ccc(-c2cc3oc4ccccc4c3c3ccccc23)cc1 |
| InChI | InChI=1S/C28H20N2O/c29-16-15-20(18-30)10-9-19-11-13-21(14-12-19)25-17-27-28(23-6-2-1-5-22(23)25)24-7-3-4-8-26(24)31-27/h1-8,10-17H,9,29H2/b16-15-,20-10+ |
| InChIKey | OYNIWNCFFYODAG-VQPMWACXSA-N |
| XLogP | 6.87 |
| TPSA | 62.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|