C18H17NO — CID 145334368
(1Z,3Z)-5-dibenzofuran-2-yl-3-methylpenta-1,3-dien-1-amine (PubChem CID 145334368) has the molecular formula C18H17NO and a molecular weight of 263.34 g/mol. Its IUPAC name is (1Z,3Z)-5-dibenzofuran-2-yl-3-methylpenta-1,3-dien-1-amine.
| Compound Name | (1Z,3Z)-5-dibenzofuran-2-yl-3-methylpenta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 145334368 |
| Molecular Formula | C18H17NO |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (1Z,3Z)-5-dibenzofuran-2-yl-3-methylpenta-1,3-dien-1-amine |
| SMILES | CC(/C=C\N)=C/Cc1ccc2oc3ccccc3c2c1 |
| InChI | InChI=1S/C18H17NO/c1-13(10-11-19)6-7-14-8-9-18-16(12-14)15-4-2-3-5-17(15)20-18/h2-6,8-12H,7,19H2,1H3/b11-10-,13-6- |
| InChIKey | RXFQKRKVKAVGOV-LYYCVXFUSA-N |
| XLogP | 4.55 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|