C23H13NO — CID 89027124
5-(4-isocyanophenyl)naphtho[2,1-b][1]benzofuran (PubChem CID 89027124) has the molecular formula C23H13NO and a molecular weight of 319.36 g/mol. Its IUPAC name is 5-(4-isocyanophenyl)naphtho[2,1-b][1]benzofuran.
| Compound Name | 5-(4-isocyanophenyl)naphtho[2,1-b][1]benzofuran |
|---|---|
| PubChem CID | 89027124 |
| Molecular Formula | C23H13NO |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | 5-(4-isocyanophenyl)naphtho[2,1-b][1]benzofuran |
| SMILES | [C-]#[N+]c1ccc(-c2cc3oc4ccccc4c3c3ccccc23)cc1 |
| InChI | InChI=1S/C23H13NO/c1-24-16-12-10-15(11-13-16)20-14-22-23(18-7-3-2-6-17(18)20)19-8-4-5-9-21(19)25-22/h2-14H |
| InChIKey | SHHGWDSNGJCWNP-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 17.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|