C52H30N4O — CID 176817809
2-[5-[4-(4-isocyanophenyl)phenyl]naphtho[1,2-b][1]benzofuran-8-yl]-4,6-dinaphthalen-2-yl-1,3,5-triazine (PubChem CID 176817809) has the molecular formula C52H30N4O and a molecular weight of 726.84 g/mol. Its IUPAC name is 2-[5-[4-(4-isocyanophenyl)phenyl]naphtho[1,2-b][1]benzofuran-8-yl]-4,6-dinaphthalen-2-yl-1,3,5-triazine.
| Compound Name | 2-[5-[4-(4-isocyanophenyl)phenyl]naphtho[1,2-b][1]benzofuran-8-yl]-4,6-dinaphthalen-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 176817809 |
| Molecular Formula | C52H30N4O |
| Molecular Weight | 726.84 g/mol |
| Exact Mass | 726.24 |
| IUPAC Name | 2-[5-[4-(4-isocyanophenyl)phenyl]naphtho[1,2-b][1]benzofuran-8-yl]-4,6-dinaphthalen-2-yl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(-c3cc4c5cc(-c6nc(-c7ccc8ccccc8c7)nc(-c7ccc8ccccc8c7)n6)ccc5oc4c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C52H30N4O/c1-53-42-25-22-35(23-26-42)34-14-18-36(19-15-34)45-31-47-46-30-41(24-27-48(46)57-49(47)44-13-7-6-12-43(44)45)52-55-50(39-20-16-32-8-2-4-10-37(32)28-39)54-51(56-52)40-21-17-33-9-3-5-11-38(33)29-40/h2-31H |
| InChIKey | WZGUXINVMIYPGB-UHFFFAOYSA-N |
| XLogP | 14.12 |
| TPSA | 56.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.84 |
| LogP ≤ 5 | 14.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|