C40H23N5O — CID 164821743
9-[4-(4-isocyanophenyl)-6-(8-phenyldibenzofuran-4-yl)-1,3,5-triazin-2-yl]carbazole (PubChem CID 164821743) has the molecular formula C40H23N5O and a molecular weight of 589.66 g/mol. Its IUPAC name is 9-[4-(4-isocyanophenyl)-6-(8-phenyldibenzofuran-4-yl)-1,3,5-triazin-2-yl]carbazole.
| Compound Name | 9-[4-(4-isocyanophenyl)-6-(8-phenyldibenzofuran-4-yl)-1,3,5-triazin-2-yl]carbazole |
|---|---|
| PubChem CID | 164821743 |
| Molecular Formula | C40H23N5O |
| Molecular Weight | 589.66 g/mol |
| Exact Mass | 589.19 |
| IUPAC Name | 9-[4-(4-isocyanophenyl)-6-(8-phenyldibenzofuran-4-yl)-1,3,5-triazin-2-yl]carbazole |
| SMILES | [C-]#[N+]c1ccc(-c2nc(-c3cccc4c3oc3ccc(-c5ccccc5)cc34)nc(-n3c4ccccc4c4ccccc43)n2)cc1 |
| InChI | InChI=1S/C40H23N5O/c1-41-28-21-18-26(19-22-28)38-42-39(44-40(43-38)45-34-16-7-5-12-29(34)30-13-6-8-17-35(30)45)32-15-9-14-31-33-24-27(25-10-3-2-4-11-25)20-23-36(33)46-37(31)32/h2-24H |
| InChIKey | WJBRYDAIVFCWRK-UHFFFAOYSA-N |
| XLogP | 10.42 |
| TPSA | 61.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.66 |
| LogP ≤ 5 | 10.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|