C26H18N2O — CID 144925119
(2E,4E)-5-amino-2-methyl-4-(12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-9-yl)penta-2,4-dienenitrile (PubChem CID 144925119) has the molecular formula C26H18N2O and a molecular weight of 374.44 g/mol. Its IUPAC name is (2E,4E)-5-amino-2-methyl-4-(12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-9-yl)penta-2,4-dienenitrile.
| Compound Name | (2E,4E)-5-amino-2-methyl-4-(12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-9-yl)penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 144925119 |
| Molecular Formula | C26H18N2O |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (2E,4E)-5-amino-2-methyl-4-(12-oxapentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaen-9-yl)penta-2,4-dienenitrile |
| SMILES | C/C(C#N)=C\C(=C/N)c1cc2oc3ccc4ccccc4c3c2c2ccccc12 |
| InChI | InChI=1S/C26H18N2O/c1-16(14-27)12-18(15-28)22-13-24-26(21-9-5-4-8-20(21)22)25-19-7-3-2-6-17(19)10-11-23(25)29-24/h2-13,15H,28H2,1H3/b16-12+,18-15+ |
| InChIKey | CKJTWVSOLFMHLH-GBHPYOBUSA-N |
| XLogP | 6.66 |
| TPSA | 62.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|