About 2-prop-2-enylpyrene
2-prop-2-enylpyrene (PubChem CID 173060600) has the molecular formula C19H14
and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-prop-2-enylpyrene.
Molecular Properties
| Compound Name | 2-prop-2-enylpyrene |
| PubChem CID | 173060600 |
| Molecular Formula | C19H14 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 2-prop-2-enylpyrene |
| SMILES | C=CCc1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C19H14/c1-2-4-13-11-16-9-7-14-5-3-6-15-8-10-17(12-13)19(16)18(14)15/h2-3,5-12H,1,4H2 |
| InChIKey | CITATAJSAWNYGC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-enylpyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-enylpyrene?
The IUPAC name of 2-prop-2-enylpyrene (CID 173060600) is 2-prop-2-enylpyrene.
What is the SMILES notation for 2-prop-2-enylpyrene?
The canonical SMILES for 2-prop-2-enylpyrene is C=CCc1cc2ccc3cccc4ccc(c1)c2c34.
What is the InChIKey of 2-prop-2-enylpyrene?
The InChIKey is CITATAJSAWNYGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H14/c1-2-4-13-11-16-9-7-14-5-3-6-15-8-10-17(12-13)19(16)18(14)15/h2-3,5-12H,1,4H2.
What are the key properties of 2-prop-2-enylpyrene?
2-prop-2-enylpyrene has a molecular weight of 242.32 g/mol, XLogP of 5.31, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-enylpyrene is sourced from PubChem (CID 173060600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).