C36H30N2 — CID 144924786
(E)-2-[(Z)-2-aminoethenyl]-4-[4-[4-(5,6-dihydronaphthalen-2-yl)-2,3-bis(ethenyl)naphthalen-1-yl]phenyl]but-2-enenitrile (PubChem CID 144924786) has the molecular formula C36H30N2 and a molecular weight of 490.65 g/mol. Its IUPAC name is (E)-2-[(Z)-2-aminoethenyl]-4-[4-[4-(5,6-dihydronaphthalen-2-yl)-2,3-bis(ethenyl)naphthalen-1-yl]phenyl]but-2-enenitrile.
| Compound Name | (E)-2-[(Z)-2-aminoethenyl]-4-[4-[4-(5,6-dihydronaphthalen-2-yl)-2,3-bis(ethenyl)naphthalen-1-yl]phenyl]but-2-enenitrile |
|---|---|
| PubChem CID | 144924786 |
| Molecular Formula | C36H30N2 |
| Molecular Weight | 490.65 g/mol |
| Exact Mass | 490.24 |
| IUPAC Name | (E)-2-[(Z)-2-aminoethenyl]-4-[4-[4-(5,6-dihydronaphthalen-2-yl)-2,3-bis(ethenyl)naphthalen-1-yl]phenyl]but-2-enenitrile |
| SMILES | C=Cc1c(C=C)c(-c2ccc3c(c2)C=CCC3)c2ccccc2c1-c1ccc(C/C=C(C#N)\C=C/N)cc1 |
| InChI | InChI=1S/C36H30N2/c1-3-31-32(4-2)36(30-20-19-27-9-5-6-10-29(27)23-30)34-12-8-7-11-33(34)35(31)28-17-15-25(16-18-28)13-14-26(24-38)21-22-37/h3-4,6-8,10-12,14-23H,1-2,5,9,13,37H2/b22-21-,26-14+ |
| InChIKey | HURORXKIGLJIFJ-GYJILVDQSA-N |
| XLogP | 8.88 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.65 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|