C38H32N2 — CID 144925182
(E)-4-[4-(6,9-diphenylcarbazol-3-yl)phenyl]-2-ethenylbut-2-enenitrile;ethane (PubChem CID 144925182) has the molecular formula C38H32N2 and a molecular weight of 516.69 g/mol. Its IUPAC name is (E)-4-[4-(6,9-diphenylcarbazol-3-yl)phenyl]-2-ethenylbut-2-enenitrile;ethane.
| Compound Name | (E)-4-[4-(6,9-diphenylcarbazol-3-yl)phenyl]-2-ethenylbut-2-enenitrile;ethane |
|---|---|
| PubChem CID | 144925182 |
| Molecular Formula | C38H32N2 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.26 |
| IUPAC Name | (E)-4-[4-(6,9-diphenylcarbazol-3-yl)phenyl]-2-ethenylbut-2-enenitrile;ethane |
| SMILES | C=C/C(C#N)=C\Cc1ccc(-c2ccc3c(c2)c2cc(-c4ccccc4)ccc2n3-c2ccccc2)cc1.CC |
| InChI | InChI=1S/C36H26N2.C2H6/c1-2-26(25-37)13-14-27-15-17-29(18-16-27)31-20-22-36-34(24-31)33-23-30(28-9-5-3-6-10-28)19-21-35(33)38(36)32-11-7-4-8-12-32;1-2/h2-13,15-24H,1,14H2;1-2H3/b26-13+; |
| InChIKey | NOZREZAJDMJWHT-WDEXQARFSA-N |
| XLogP | 10.32 |
| TPSA | 28.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 10.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|