C35H29N3 — CID 144924519
(2E,5Z,7Z)-5-amino-9-(6,9-diphenylcarbazol-3-yl)-2-methyl-4-methylidenenona-2,5,7-trienenitrile (PubChem CID 144924519) has the molecular formula C35H29N3 and a molecular weight of 491.64 g/mol. Its IUPAC name is (2E,5Z,7Z)-5-amino-9-(6,9-diphenylcarbazol-3-yl)-2-methyl-4-methylidenenona-2,5,7-trienenitrile.
| Compound Name | (2E,5Z,7Z)-5-amino-9-(6,9-diphenylcarbazol-3-yl)-2-methyl-4-methylidenenona-2,5,7-trienenitrile |
|---|---|
| PubChem CID | 144924519 |
| Molecular Formula | C35H29N3 |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.24 |
| IUPAC Name | (2E,5Z,7Z)-5-amino-9-(6,9-diphenylcarbazol-3-yl)-2-methyl-4-methylidenenona-2,5,7-trienenitrile |
| SMILES | C=C(/C=C(\C)C#N)/C(N)=C\C=C/Cc1ccc2c(c1)c1cc(-c3ccccc3)ccc1n2-c1ccccc1 |
| InChI | InChI=1S/C35H29N3/c1-25(24-36)21-26(2)33(37)16-10-9-11-27-17-19-34-31(22-27)32-23-29(28-12-5-3-6-13-28)18-20-35(32)38(34)30-14-7-4-8-15-30/h3-10,12-23H,2,11,37H2,1H3/b10-9-,25-21+,33-16- |
| InChIKey | FWZRGKVFQMAMMF-WYXIVRKESA-N |
| XLogP | 8.42 |
| TPSA | 54.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|