C47H42N2 — CID 144924647
ethane;(2E)-2-methanimidoyl-4-[4-(6,9,9-triphenylfluoren-3-yl)phenyl]penta-2,4-dienenitrile (PubChem CID 144924647) has the molecular formula C47H42N2 and a molecular weight of 634.87 g/mol. Its IUPAC name is ethane;(2E)-2-methanimidoyl-4-[4-(6,9,9-triphenylfluoren-3-yl)phenyl]penta-2,4-dienenitrile.
| Compound Name | ethane;(2E)-2-methanimidoyl-4-[4-(6,9,9-triphenylfluoren-3-yl)phenyl]penta-2,4-dienenitrile |
|---|---|
| PubChem CID | 144924647 |
| Molecular Formula | C47H42N2 |
| Molecular Weight | 634.87 g/mol |
| Exact Mass | 634.33 |
| IUPAC Name | ethane;(2E)-2-methanimidoyl-4-[4-(6,9,9-triphenylfluoren-3-yl)phenyl]penta-2,4-dienenitrile |
| SMILES | CC.CC.[H]/N=C/C(C#N)=C\C(=C)c1ccc(-c2ccc3c(c2)-c2cc(-c4ccccc4)ccc2C3(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C43H30N2.2C2H6/c1-30(25-31(28-44)29-45)32-17-19-34(20-18-32)36-22-24-42-40(27-36)39-26-35(33-11-5-2-6-12-33)21-23-41(39)43(42,37-13-7-3-8-14-37)38-15-9-4-10-16-38;2*1-2/h2-28,44H,1H2;2*1-2H3/b31-25+,44-28+;; |
| InChIKey | JHBLXNVZYXXFOU-WZIFETNCSA-N |
| XLogP | 12.55 |
| TPSA | 47.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.87 |
| LogP ≤ 5 | 12.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|