C37H24N4 — CID 144925213
5-[6-[(3E)-4-cyano-5-iminopenta-1,3-dien-2-yl]-9,9-diphenylfluoren-3-yl]pyridine-3-carbonitrile (PubChem CID 144925213) has the molecular formula C37H24N4 and a molecular weight of 524.63 g/mol. Its IUPAC name is 5-[6-[(3E)-4-cyano-5-iminopenta-1,3-dien-2-yl]-9,9-diphenylfluoren-3-yl]pyridine-3-carbonitrile.
| Compound Name | 5-[6-[(3E)-4-cyano-5-iminopenta-1,3-dien-2-yl]-9,9-diphenylfluoren-3-yl]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 144925213 |
| Molecular Formula | C37H24N4 |
| Molecular Weight | 524.63 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | 5-[6-[(3E)-4-cyano-5-iminopenta-1,3-dien-2-yl]-9,9-diphenylfluoren-3-yl]pyridine-3-carbonitrile |
| SMILES | [H]/N=C/C(C#N)=C\C(=C)c1ccc2c(c1)-c1cc(-c3cncc(C#N)c3)ccc1C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H24N4/c1-25(16-26(20-38)21-39)28-12-14-35-33(18-28)34-19-29(30-17-27(22-40)23-41-24-30)13-15-36(34)37(35,31-8-4-2-5-9-31)32-10-6-3-7-11-32/h2-20,23-24,38H,1H2/b26-16+,38-20+ |
| InChIKey | CGPNGCIJNOTTJZ-NUUJZLACSA-N |
| XLogP | 8.10 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.63 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|