C45H28N2 — CID 140769471
4-[3-(12,12-diphenyl-9-pentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaenyl)phenyl]-2-isocyanopyridine (PubChem CID 140769471) has the molecular formula C45H28N2 and a molecular weight of 596.73 g/mol. Its IUPAC name is 4-[3-(12,12-diphenyl-9-pentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaenyl)phenyl]-2-isocyanopyridine.
| Compound Name | 4-[3-(12,12-diphenyl-9-pentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaenyl)phenyl]-2-isocyanopyridine |
|---|---|
| PubChem CID | 140769471 |
| Molecular Formula | C45H28N2 |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | 4-[3-(12,12-diphenyl-9-pentacyclo[11.8.0.02,11.03,8.016,21]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaenyl)phenyl]-2-isocyanopyridine |
| SMILES | [C-]#[N+]c1cc(-c2cccc(-c3cc4c(c5ccccc35)-c3c(ccc5ccccc35)C4(c3ccccc3)c3ccccc3)c2)ccn1 |
| InChI | InChI=1S/C45H28N2/c1-46-42-28-32(25-26-47-42)31-14-12-15-33(27-31)39-29-41-44(38-22-11-10-21-37(38)39)43-36-20-9-8-13-30(36)23-24-40(43)45(41,34-16-4-2-5-17-34)35-18-6-3-7-19-35/h2-29H |
| InChIKey | RFNKLADLVGMGGF-UHFFFAOYSA-N |
| XLogP | 11.64 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 11.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|