C41H26N2 — CID 140768911
3-[3-(7,7-diphenylbenzo[g]fluoren-9-yl)phenyl]-5-isocyanopyridine (PubChem CID 140768911) has the molecular formula C41H26N2 and a molecular weight of 546.67 g/mol. Its IUPAC name is 3-[3-(7,7-diphenylbenzo[g]fluoren-9-yl)phenyl]-5-isocyanopyridine.
| Compound Name | 3-[3-(7,7-diphenylbenzo[g]fluoren-9-yl)phenyl]-5-isocyanopyridine |
|---|---|
| PubChem CID | 140768911 |
| Molecular Formula | C41H26N2 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.21 |
| IUPAC Name | 3-[3-(7,7-diphenylbenzo[g]fluoren-9-yl)phenyl]-5-isocyanopyridine |
| SMILES | [C-]#[N+]c1cncc(-c2cccc(-c3ccc4c(c3)C(c3ccccc3)(c3ccccc3)c3ccc5ccccc5c3-4)c2)c1 |
| InChI | InChI=1S/C41H26N2/c1-42-35-24-32(26-43-27-35)30-13-10-12-29(23-30)31-19-21-37-39(25-31)41(33-14-4-2-5-15-33,34-16-6-3-7-17-34)38-22-20-28-11-8-9-18-36(28)40(37)38/h2-27H |
| InChIKey | IGYQXCFICWWXCJ-UHFFFAOYSA-N |
| XLogP | 10.48 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 10.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|