C47H28N2 — CID 140769113
3-isocyano-5-[3-(5-phenylspiro[benzo[g]fluorene-7,9'-fluorene]-9-yl)phenyl]pyridine (PubChem CID 140769113) has the molecular formula C47H28N2 and a molecular weight of 620.76 g/mol. Its IUPAC name is 3-isocyano-5-[3-(5-phenylspiro[benzo[g]fluorene-7,9'-fluorene]-9-yl)phenyl]pyridine.
| Compound Name | 3-isocyano-5-[3-(5-phenylspiro[benzo[g]fluorene-7,9'-fluorene]-9-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 140769113 |
| Molecular Formula | C47H28N2 |
| Molecular Weight | 620.76 g/mol |
| Exact Mass | 620.23 |
| IUPAC Name | 3-isocyano-5-[3-(5-phenylspiro[benzo[g]fluorene-7,9'-fluorene]-9-yl)phenyl]pyridine |
| SMILES | [C-]#[N+]c1cncc(-c2cccc(-c3ccc4c(c3)C3(c5ccccc5-c5ccccc53)c3cc(-c5ccccc5)c5ccccc5c3-4)c2)c1 |
| InChI | InChI=1S/C47H28N2/c1-48-35-25-34(28-49-29-35)32-15-11-14-31(24-32)33-22-23-40-44(26-33)47(42-20-9-7-17-37(42)38-18-8-10-21-43(38)47)45-27-41(30-12-3-2-4-13-30)36-16-5-6-19-39(36)46(40)45/h2-29H |
| InChIKey | ZQRAWSBHUNPRMP-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 17.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.76 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|