About CID 140770870
CID 140770870 (PubChem CID 140770870) has the molecular formula C15H20BN2O6
and a molecular weight of 335.15 g/mol.
Molecular Properties
| Compound Name | CID 140770870 |
| PubChem CID | 140770870 |
| Molecular Formula | C15H20BN2O6 |
| Molecular Weight | 335.15 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | — |
| SMILES | CC(C)(C)OC(=O)C[C@H](COc1cccc([N+](=O)[O-])c1)N[B]C=O |
| InChI | InChI=1S/C15H20BN2O6/c1-15(2,3)24-14(20)7-11(17-16-10-19)9-23-13-6-4-5-12(8-13)18(21)22/h4-6,8,10-11,17H,7,9H2,1-3H3/t11-/m1/s1 |
| InChIKey | WANFKWOUMLPJRG-LLVKDONJSA-N |
| XLogP | 1.47 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.15 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 140770870 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 140770870?
The IUPAC name of CID 140770870 (CID 140770870) is not available.
What is the SMILES notation for CID 140770870?
The canonical SMILES for CID 140770870 is CC(C)(C)OC(=O)C[C@H](COc1cccc([N+](=O)[O-])c1)N[B]C=O.
What is the InChIKey of CID 140770870?
The InChIKey is WANFKWOUMLPJRG-LLVKDONJSA-N. The full InChI is InChI=1S/C15H20BN2O6/c1-15(2,3)24-14(20)7-11(17-16-10-19)9-23-13-6-4-5-12(8-13)18(21)22/h4-6,8,10-11,17H,7,9H2,1-3H3/t11-/m1/s1.
What are the key properties of CID 140770870?
CID 140770870 has a molecular weight of 335.15 g/mol, XLogP of 1.47, 9 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 140770870 is sourced from PubChem (CID 140770870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).