C28H43N5O6SSi — CID 140771344
(2R,3S)-N-[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]-3-hydroxy-4,4-dimethyl-N-(2-trimethylsilylethyl)pentane-2-sulfonamide (PubChem CID 140771344) has the molecular formula C28H43N5O6SSi and a molecular weight of 605.83 g/mol. Its IUPAC name is (2R,3S)-N-[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]-3-hydroxy-4,4-dimethyl-N-(2-trimethylsilylethyl)pentane-2-sulfonamide.
| Compound Name | (2R,3S)-N-[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]-3-hydroxy-4,4-dimethyl-N-(2-trimethylsilylethyl)pentane-2-sulfonamide |
|---|---|
| PubChem CID | 140771344 |
| Molecular Formula | C28H43N5O6SSi |
| Molecular Weight | 605.83 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | (2R,3S)-N-[4-(2,6-dimethoxyphenyl)-5-(6-methoxy-2-pyridinyl)-1,2,4-triazol-3-yl]-3-hydroxy-4,4-dimethyl-N-(2-trimethylsilylethyl)pentane-2-sulfonamide |
| SMILES | COc1cccc(-c2nnc(N(CC[Si](C)(C)C)S(=O)(=O)[C@H](C)[C@@H](O)C(C)(C)C)n2-c2c(OC)cccc2OC)n1 |
| InChI | InChI=1S/C28H43N5O6SSi/c1-19(25(34)28(2,3)4)40(35,36)32(17-18-41(8,9)10)27-31-30-26(20-13-11-16-23(29-20)39-7)33(27)24-21(37-5)14-12-15-22(24)38-6/h11-16,19,25,34H,17-18H2,1-10H3/t19-,25-/m1/s1 |
| InChIKey | SAYFYNBUIYUUIF-KBMIEXCESA-N |
| XLogP | 4.62 |
| TPSA | 128.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.83 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|