C31H38F2N4O6SSi — CID 140772547
(1R,2R)-1-(2,4-difluorophenyl)-N-[4-(2,6-dimethoxyphenyl)-5-(3-methoxyphenyl)-1,2,4-triazol-3-yl]-1-hydroxy-N-(2-trimethylsilylethyl)propane-2-sulfonamide (PubChem CID 140772547) has the molecular formula C31H38F2N4O6SSi and a molecular weight of 660.82 g/mol. Its IUPAC name is (1R,2R)-1-(2,4-difluorophenyl)-N-[4-(2,6-dimethoxyphenyl)-5-(3-methoxyphenyl)-1,2,4-triazol-3-yl]-1-hydroxy-N-(2-trimethylsilylethyl)propane-2-sulfonamide.
| Compound Name | (1R,2R)-1-(2,4-difluorophenyl)-N-[4-(2,6-dimethoxyphenyl)-5-(3-methoxyphenyl)-1,2,4-triazol-3-yl]-1-hydroxy-N-(2-trimethylsilylethyl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 140772547 |
| Molecular Formula | C31H38F2N4O6SSi |
| Molecular Weight | 660.82 g/mol |
| Exact Mass | 660.22 |
| IUPAC Name | (1R,2R)-1-(2,4-difluorophenyl)-N-[4-(2,6-dimethoxyphenyl)-5-(3-methoxyphenyl)-1,2,4-triazol-3-yl]-1-hydroxy-N-(2-trimethylsilylethyl)propane-2-sulfonamide |
| SMILES | COc1cccc(-c2nnc(N(CC[Si](C)(C)C)S(=O)(=O)[C@H](C)[C@H](O)c3ccc(F)cc3F)n2-c2c(OC)cccc2OC)c1 |
| InChI | InChI=1S/C31H38F2N4O6SSi/c1-20(29(38)24-15-14-22(32)19-25(24)33)44(39,40)36(16-17-45(5,6)7)31-35-34-30(21-10-8-11-23(18-21)41-2)37(31)28-26(42-3)12-9-13-27(28)43-4/h8-15,18-20,29,38H,16-17H2,1-7H3/t20-,29+/m1/s1 |
| InChIKey | DFLYUGROGCLFCN-OLILMLBXSA-N |
| XLogP | 5.83 |
| TPSA | 116.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.82 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|