C13H10CaO9S3 — CID 140773270
calcium 1-prop-1-en-2-yloxysulfonylnaphthalene-2,3-disulfonate (PubChem CID 140773270) has the molecular formula C13H10CaO9S3 and a molecular weight of 446.49 g/mol. Its IUPAC name is calcium 1-prop-1-en-2-yloxysulfonylnaphthalene-2,3-disulfonate.
| Compound Name | calcium 1-prop-1-en-2-yloxysulfonylnaphthalene-2,3-disulfonate |
|---|---|
| PubChem CID | 140773270 |
| Molecular Formula | C13H10CaO9S3 |
| Molecular Weight | 446.49 g/mol |
| Exact Mass | 445.91 |
| IUPAC Name | calcium 1-prop-1-en-2-yloxysulfonylnaphthalene-2,3-disulfonate |
| SMILES | C=C(C)OS(=O)(=O)c1c(S(=O)(=O)[O-])c(S(=O)(=O)[O-])cc2ccccc12.[Ca+2] |
| InChI | InChI=1S/C13H12O9S3.Ca/c1-8(2)22-25(20,21)12-10-6-4-3-5-9(10)7-11(23(14,15)16)13(12)24(17,18)19;/h3-7H,1H2,2H3,(H,14,15,16)(H,17,18,19);/q;+2/p-2 |
| InChIKey | REENIGCVVUFQPF-UHFFFAOYSA-L |
| XLogP | 0.51 |
| TPSA | 157.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.49 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|