C22H11F20O9S3- — CID 158520987
3,4-bis(2,2,3,3,4,4,5,5,6,6-decafluorohexoxysulfonyl)naphthalene-2-sulfonate (PubChem CID 158520987) has the molecular formula C22H11F20O9S3- and a molecular weight of 895.48 g/mol. Its IUPAC name is 3,4-bis(2,2,3,3,4,4,5,5,6,6-decafluorohexoxysulfonyl)naphthalene-2-sulfonate.
| Compound Name | 3,4-bis(2,2,3,3,4,4,5,5,6,6-decafluorohexoxysulfonyl)naphthalene-2-sulfonate |
|---|---|
| PubChem CID | 158520987 |
| Molecular Formula | C22H11F20O9S3- |
| Molecular Weight | 895.48 g/mol |
| Exact Mass | 894.93 |
| IUPAC Name | 3,4-bis(2,2,3,3,4,4,5,5,6,6-decafluorohexoxysulfonyl)naphthalene-2-sulfonate |
| SMILES | O=S(=O)([O-])c1cc2ccccc2c(S(=O)(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)c1S(=O)(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C22H12F20O9S3/c23-13(24)17(31,32)21(39,40)19(35,36)15(27,28)6-50-53(46,47)11-9-4-2-1-3-8(9)5-10(52(43,44)45)12(11)54(48,49)51-7-16(29,30)20(37,38)22(41,42)18(33,34)14(25)26/h1-5,13-14H,6-7H2,(H,43,44,45)/p-1 |
| InChIKey | HMFANKXIIBKTOX-UHFFFAOYSA-M |
| XLogP | 6.77 |
| TPSA | 143.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.48 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|