C17H9F12NaO3S — CID 139969525
sodium 5-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)naphthalene-1-sulfonate (PubChem CID 139969525) has the molecular formula C17H9F12NaO3S and a molecular weight of 544.29 g/mol. Its IUPAC name is sodium 5-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)naphthalene-1-sulfonate.
| Compound Name | sodium 5-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 139969525 |
| Molecular Formula | C17H9F12NaO3S |
| Molecular Weight | 544.29 g/mol |
| Exact Mass | 544.00 |
| IUPAC Name | sodium 5-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)naphthalene-1-sulfonate |
| SMILES | O=S(=O)([O-])c1cccc2c(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F)cccc12.[Na+] |
| InChI | InChI=1S/C17H10F12O3S.Na/c18-12(19)14(22,23)16(26,27)17(28,29)15(24,25)13(20,21)7-8-3-1-5-10-9(8)4-2-6-11(10)33(30,31)32;/h1-6,12H,7H2,(H,30,31,32);/q;+1/p-1 |
| InChIKey | HXKIOKJSSFEOGT-UHFFFAOYSA-M |
| XLogP | 2.73 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|