C29H36N4OSi — CID 140775620
N-methyl-1-[2-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]-1,3-dihydroinden-2-yl]methanamine (PubChem CID 140775620) has the molecular formula C29H36N4OSi and a molecular weight of 484.72 g/mol. Its IUPAC name is N-methyl-1-[2-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]-1,3-dihydroinden-2-yl]methanamine.
| Compound Name | N-methyl-1-[2-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]-1,3-dihydroinden-2-yl]methanamine |
|---|---|
| PubChem CID | 140775620 |
| Molecular Formula | C29H36N4OSi |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | N-methyl-1-[2-[3-[7-(2-trimethylsilylethoxymethyl)pyrrolo[2,3-d]pyrimidin-4-yl]phenyl]-1,3-dihydroinden-2-yl]methanamine |
| SMILES | CNCC1(c2cccc(-c3ncnc4c3ccn4COCC[Si](C)(C)C)c2)Cc2ccccc2C1 |
| InChI | InChI=1S/C29H36N4OSi/c1-30-19-29(17-23-8-5-6-9-24(23)18-29)25-11-7-10-22(16-25)27-26-12-13-33(28(26)32-20-31-27)21-34-14-15-35(2,3)4/h5-13,16,20,30H,14-15,17-19,21H2,1-4H3 |
| InChIKey | KZTBYNSSTMDMLR-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|