C19H36N2O — CID 140775967
1-[(2S)-2-amino-2-cyclohexylethyl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide (PubChem CID 140775967) has the molecular formula C19H36N2O and a molecular weight of 308.51 g/mol. Its IUPAC name is 1-[(2S)-2-amino-2-cyclohexylethyl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide.
| Compound Name | 1-[(2S)-2-amino-2-cyclohexylethyl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 140775967 |
| Molecular Formula | C19H36N2O |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.28 |
| IUPAC Name | 1-[(2S)-2-amino-2-cyclohexylethyl]-5-methyl-2-propan-2-ylcyclohexane-1-carboxamide |
| SMILES | CC1CCC(C(C)C)C(C[C@H](N)C2CCCCC2)(C(N)=O)C1 |
| InChI | InChI=1S/C19H36N2O/c1-13(2)16-10-9-14(3)11-19(16,18(21)22)12-17(20)15-7-5-4-6-8-15/h13-17H,4-12,20H2,1-3H3,(H2,21,22)/t14?,16?,17-,19?/m0/s1 |
| InChIKey | NQOJENPKIZZDCC-KBILYXEQSA-N |
| XLogP | 3.85 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |