C15H27NO3 — CID 68627782
ethyl 2-(1-carbamoyl-5-methyl-2-propan-2-ylcyclohexyl)acetate (PubChem CID 68627782) has the molecular formula C15H27NO3 and a molecular weight of 269.38 g/mol. Its IUPAC name is ethyl 2-(1-carbamoyl-5-methyl-2-propan-2-ylcyclohexyl)acetate.
| Compound Name | ethyl 2-(1-carbamoyl-5-methyl-2-propan-2-ylcyclohexyl)acetate |
|---|---|
| PubChem CID | 68627782 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | ethyl 2-(1-carbamoyl-5-methyl-2-propan-2-ylcyclohexyl)acetate |
| SMILES | CCOC(=O)CC1(C(N)=O)CC(C)CCC1C(C)C |
| InChI | InChI=1S/C15H27NO3/c1-5-19-13(17)9-15(14(16)18)8-11(4)6-7-12(15)10(2)3/h10-12H,5-9H2,1-4H3,(H2,16,18) |
| InChIKey | KQIWGAPGFYVTGS-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |