C12H9F4NO7 — CID 140776243
2-[(1R)-1-[4-(difluoromethoxy)-2,6-difluorophenyl]-2-nitroethyl]propanedioic acid (PubChem CID 140776243) has the molecular formula C12H9F4NO7 and a molecular weight of 355.20 g/mol. Its IUPAC name is 2-[(1R)-1-[4-(difluoromethoxy)-2,6-difluorophenyl]-2-nitroethyl]propanedioic acid.
| Compound Name | 2-[(1R)-1-[4-(difluoromethoxy)-2,6-difluorophenyl]-2-nitroethyl]propanedioic acid |
|---|---|
| PubChem CID | 140776243 |
| Molecular Formula | C12H9F4NO7 |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | 2-[(1R)-1-[4-(difluoromethoxy)-2,6-difluorophenyl]-2-nitroethyl]propanedioic acid |
| SMILES | O=C(O)C(C(=O)O)[C@@H](C[N+](=O)[O-])c1c(F)cc(OC(F)F)cc1F |
| InChI | InChI=1S/C12H9F4NO7/c13-6-1-4(24-12(15)16)2-7(14)8(6)5(3-17(22)23)9(10(18)19)11(20)21/h1-2,5,9,12H,3H2,(H,18,19)(H,20,21)/t5-/m0/s1 |
| InChIKey | USAQRBANAFXMPD-YFKPBYRVSA-N |
| XLogP | 1.71 |
| TPSA | 126.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|