C19H24F2N2O8 — CID 126643686
dimethyl 2-[1-[2,6-difluoro-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]-2-nitroethyl]propanedioate (PubChem CID 126643686) has the molecular formula C19H24F2N2O8 and a molecular weight of 446.40 g/mol. Its IUPAC name is dimethyl 2-[1-[2,6-difluoro-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]-2-nitroethyl]propanedioate.
| Compound Name | dimethyl 2-[1-[2,6-difluoro-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]-2-nitroethyl]propanedioate |
|---|---|
| PubChem CID | 126643686 |
| Molecular Formula | C19H24F2N2O8 |
| Molecular Weight | 446.40 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | dimethyl 2-[1-[2,6-difluoro-4-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]phenyl]-2-nitroethyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)C(C[N+](=O)[O-])c1c(F)cc(N(C)C(=O)OC(C)(C)C)cc1F |
| InChI | InChI=1S/C19H24F2N2O8/c1-19(2,3)31-18(26)22(4)10-7-12(20)14(13(21)8-10)11(9-23(27)28)15(16(24)29-5)17(25)30-6/h7-8,11,15H,9H2,1-6H3 |
| InChIKey | IQAZMFSNFCFHHI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.40 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|