C16H18FNO7 — CID 122583077
dimethyl 2-[(1R)-1-(7-fluoro-3,4-dihydro-2H-chromen-6-yl)-2-nitroethyl]propanedioate (PubChem CID 122583077) has the molecular formula C16H18FNO7 and a molecular weight of 355.32 g/mol. Its IUPAC name is dimethyl 2-[(1R)-1-(7-fluoro-3,4-dihydro-2H-chromen-6-yl)-2-nitroethyl]propanedioate.
| Compound Name | dimethyl 2-[(1R)-1-(7-fluoro-3,4-dihydro-2H-chromen-6-yl)-2-nitroethyl]propanedioate |
|---|---|
| PubChem CID | 122583077 |
| Molecular Formula | C16H18FNO7 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | dimethyl 2-[(1R)-1-(7-fluoro-3,4-dihydro-2H-chromen-6-yl)-2-nitroethyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H](C[N+](=O)[O-])c1cc2c(cc1F)OCCC2 |
| InChI | InChI=1S/C16H18FNO7/c1-23-15(19)14(16(20)24-2)11(8-18(21)22)10-6-9-4-3-5-25-13(9)7-12(10)17/h6-7,11,14H,3-5,8H2,1-2H3/t11-/m0/s1 |
| InChIKey | KTDDDBQFIJFETJ-NSHDSACASA-N |
| XLogP | 1.47 |
| TPSA | 104.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|