C13H16FNO4 — CID 126653282
methyl (3R)-3-(2-fluoro-4-methylphenyl)-2-methyl-4-nitrobutanoate (PubChem CID 126653282) has the molecular formula C13H16FNO4 and a molecular weight of 269.27 g/mol. Its IUPAC name is methyl (3R)-3-(2-fluoro-4-methylphenyl)-2-methyl-4-nitrobutanoate.
| Compound Name | methyl (3R)-3-(2-fluoro-4-methylphenyl)-2-methyl-4-nitrobutanoate |
|---|---|
| PubChem CID | 126653282 |
| Molecular Formula | C13H16FNO4 |
| Molecular Weight | 269.27 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | methyl (3R)-3-(2-fluoro-4-methylphenyl)-2-methyl-4-nitrobutanoate |
| SMILES | COC(=O)C(C)[C@@H](C[N+](=O)[O-])c1ccc(C)cc1F |
| InChI | InChI=1S/C13H16FNO4/c1-8-4-5-10(12(14)6-8)11(7-15(17)18)9(2)13(16)19-3/h4-6,9,11H,7H2,1-3H3/t9?,11-/m1/s1 |
| InChIKey | RBOFOUYGBKBGIG-HCCKASOXSA-N |
| XLogP | 2.30 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|