C14H14FNO5 — CID 126653300
methyl (3R)-3-(6-fluoro-1-benzofuran-5-yl)-2-methyl-4-nitrobutanoate (PubChem CID 126653300) has the molecular formula C14H14FNO5 and a molecular weight of 295.27 g/mol. Its IUPAC name is methyl (3R)-3-(6-fluoro-1-benzofuran-5-yl)-2-methyl-4-nitrobutanoate.
| Compound Name | methyl (3R)-3-(6-fluoro-1-benzofuran-5-yl)-2-methyl-4-nitrobutanoate |
|---|---|
| PubChem CID | 126653300 |
| Molecular Formula | C14H14FNO5 |
| Molecular Weight | 295.27 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | methyl (3R)-3-(6-fluoro-1-benzofuran-5-yl)-2-methyl-4-nitrobutanoate |
| SMILES | COC(=O)C(C)[C@@H](C[N+](=O)[O-])c1cc2ccoc2cc1F |
| InChI | InChI=1S/C14H14FNO5/c1-8(14(17)20-2)11(7-16(18)19)10-5-9-3-4-21-13(9)6-12(10)15/h3-6,8,11H,7H2,1-2H3/t8?,11-/m1/s1 |
| InChIKey | IAGOSSUAMVAKOS-QHDYGNBISA-N |
| XLogP | 2.74 |
| TPSA | 82.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.27 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|