C13H16N2O6 — CID 162137770
carbon dioxide;methyl (3R)-2-methyl-3-(6-methyl-3-pyridinyl)-4-nitrobutanoate (PubChem CID 162137770) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is carbon dioxide;methyl (3R)-2-methyl-3-(6-methyl-3-pyridinyl)-4-nitrobutanoate.
| Compound Name | carbon dioxide;methyl (3R)-2-methyl-3-(6-methyl-3-pyridinyl)-4-nitrobutanoate |
|---|---|
| PubChem CID | 162137770 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | carbon dioxide;methyl (3R)-2-methyl-3-(6-methyl-3-pyridinyl)-4-nitrobutanoate |
| SMILES | COC(=O)C(C)[C@@H](C[N+](=O)[O-])c1ccc(C)nc1.O=C=O |
| InChI | InChI=1S/C12H16N2O4.CO2/c1-8-4-5-10(6-13-8)11(7-14(16)17)9(2)12(15)18-3;2-1-3/h4-6,9,11H,7H2,1-3H3;/t9?,11-;/m1./s1 |
| InChIKey | ZJNAVKWRLKPZFA-HHDUEHQLSA-N |
| XLogP | 0.98 |
| TPSA | 116.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|