C15H19NO6 — CID 160557377
carbon dioxide;methyl (3R)-3-(2,4-dimethylphenyl)-2-methyl-4-nitrobutanoate (PubChem CID 160557377) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is carbon dioxide;methyl (3R)-3-(2,4-dimethylphenyl)-2-methyl-4-nitrobutanoate.
| Compound Name | carbon dioxide;methyl (3R)-3-(2,4-dimethylphenyl)-2-methyl-4-nitrobutanoate |
|---|---|
| PubChem CID | 160557377 |
| Molecular Formula | C15H19NO6 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | carbon dioxide;methyl (3R)-3-(2,4-dimethylphenyl)-2-methyl-4-nitrobutanoate |
| SMILES | COC(=O)C(C)[C@@H](C[N+](=O)[O-])c1ccc(C)cc1C.O=C=O |
| InChI | InChI=1S/C14H19NO4.CO2/c1-9-5-6-12(10(2)7-9)13(8-15(17)18)11(3)14(16)19-4;2-1-3/h5-7,11,13H,8H2,1-4H3;/t11?,13-;/m1./s1 |
| InChIKey | QYWAMNQSOGUHSO-ASSPZCQQSA-N |
| XLogP | 1.89 |
| TPSA | 103.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|