C12H16N2O3 — CID 47337828
methyl (2S)-2-[[2-(6-methyl-3-pyridinyl)acetyl]amino]propanoate (PubChem CID 47337828) has the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(6-methyl-3-pyridinyl)acetyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[2-(6-methyl-3-pyridinyl)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 47337828 |
| Molecular Formula | C12H16N2O3 |
| Molecular Weight | 236.27 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | methyl (2S)-2-[[2-(6-methyl-3-pyridinyl)acetyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)Cc1ccc(C)nc1 |
| InChI | InChI=1S/C12H16N2O3/c1-8-4-5-10(7-13-8)6-11(15)14-9(2)12(16)17-3/h4-5,7,9H,6H2,1-3H3,(H,14,15)/t9-/m0/s1 |
| InChIKey | AUKGQIJBNOAOTO-VIFPVBQESA-N |
| XLogP | 0.61 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |