C40H43N — CID 140777693
5-[3,5-bis(4-butylphenyl)-2,4,6-trimethylphenyl]-2-phenylpyridine (PubChem CID 140777693) has the molecular formula C40H43N and a molecular weight of 537.79 g/mol. Its IUPAC name is 5-[3,5-bis(4-butylphenyl)-2,4,6-trimethylphenyl]-2-phenylpyridine.
| Compound Name | 5-[3,5-bis(4-butylphenyl)-2,4,6-trimethylphenyl]-2-phenylpyridine |
|---|---|
| PubChem CID | 140777693 |
| Molecular Formula | C40H43N |
| Molecular Weight | 537.79 g/mol |
| Exact Mass | 537.34 |
| IUPAC Name | 5-[3,5-bis(4-butylphenyl)-2,4,6-trimethylphenyl]-2-phenylpyridine |
| SMILES | CCCCc1ccc(-c2c(C)c(-c3ccc(CCCC)cc3)c(C)c(-c3ccc(-c4ccccc4)nc3)c2C)cc1 |
| InChI | InChI=1S/C40H43N/c1-6-8-13-31-17-21-34(22-18-31)38-28(3)39(35-23-19-32(20-24-35)14-9-7-2)30(5)40(29(38)4)36-25-26-37(41-27-36)33-15-11-10-12-16-33/h10-12,15-27H,6-9,13-14H2,1-5H3 |
| InChIKey | AJDKDNBAIXITIL-UHFFFAOYSA-N |
| XLogP | 11.36 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.79 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |