C54H42S2Si2 — CID 140778867
[1,6-bis(8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-14-yl)-8-trimethylsilylpyren-4-yl]-trimethylsilane (PubChem CID 140778867) has the molecular formula C54H42S2Si2 and a molecular weight of 811.24 g/mol. Its IUPAC name is [1,6-bis(8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-14-yl)-8-trimethylsilylpyren-4-yl]-trimethylsilane.
| Compound Name | [1,6-bis(8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-14-yl)-8-trimethylsilylpyren-4-yl]-trimethylsilane |
|---|---|
| PubChem CID | 140778867 |
| Molecular Formula | C54H42S2Si2 |
| Molecular Weight | 811.24 g/mol |
| Exact Mass | 810.23 |
| IUPAC Name | [1,6-bis(8-thiatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-14-yl)-8-trimethylsilylpyren-4-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cc2c(-c3ccc4c5c(cccc35)Sc3ccccc3-4)cc([Si](C)(C)C)c3ccc4c(-c5ccc6c7c(cccc57)Sc5ccccc5-6)ccc1c4c23 |
| InChI | InChI=1S/C54H42S2Si2/c1-57(2,3)49-29-43(33-22-25-40-35-14-8-10-18-46(35)56-48-20-12-16-37(33)52(40)48)44-30-50(58(4,5)6)41-27-23-32(38-26-28-42(49)54(44)53(38)41)31-21-24-39-34-13-7-9-17-45(34)55-47-19-11-15-36(31)51(39)47/h7-30H,1-6H3 |
| InChIKey | NJZDJRZLNIOFEJ-UHFFFAOYSA-N |
| XLogP | 15.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.24 |
| LogP ≤ 5 | 15.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|