C54H42O2Si2 — CID 140778864
[3,8-bis(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl)-6-trimethylsilylpyren-1-yl]-trimethylsilane (PubChem CID 140778864) has the molecular formula C54H42O2Si2 and a molecular weight of 779.10 g/mol. Its IUPAC name is [3,8-bis(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl)-6-trimethylsilylpyren-1-yl]-trimethylsilane.
| Compound Name | [3,8-bis(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl)-6-trimethylsilylpyren-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 140778864 |
| Molecular Formula | C54H42O2Si2 |
| Molecular Weight | 779.10 g/mol |
| Exact Mass | 778.27 |
| IUPAC Name | [3,8-bis(8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(16),2,4,6,9(17),10,12,14-octaen-12-yl)-6-trimethylsilylpyren-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cc(-c2ccc3c4c(cccc24)-c2ccccc2O3)c2ccc3c([Si](C)(C)C)cc(-c4ccc5c6c(cccc46)-c4ccccc4O5)c4ccc1c2c43 |
| InChI | InChI=1S/C54H42O2Si2/c1-57(2,3)49-29-43(31-25-27-47-51-35(31)15-11-17-37(51)33-13-7-9-19-45(33)55-47)39-22-24-42-50(58(4,5)6)30-44(40-21-23-41(49)53(39)54(40)42)32-26-28-48-52-36(32)16-12-18-38(52)34-14-8-10-20-46(34)56-48/h7-30H,1-6H3 |
| InChIKey | LTRFGIKKUKRCID-UHFFFAOYSA-N |
| XLogP | 14.86 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.10 |
| LogP ≤ 5 | 14.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|