C16H9ClO — CID 142726104
14-chloro-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene (PubChem CID 142726104) has the molecular formula C16H9ClO and a molecular weight of 252.70 g/mol. Its IUPAC name is 14-chloro-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene.
| Compound Name | 14-chloro-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene |
|---|---|
| PubChem CID | 142726104 |
| Molecular Formula | C16H9ClO |
| Molecular Weight | 252.70 g/mol |
| Exact Mass | 252.03 |
| IUPAC Name | 14-chloro-8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaene |
| SMILES | Clc1ccc2c3c(cccc13)Oc1ccccc1-2 |
| InChI | InChI=1S/C16H9ClO/c17-13-9-8-11-10-4-1-2-6-14(10)18-15-7-3-5-12(13)16(11)15/h1-9H |
| InChIKey | NIHKCDZUSXOXGJ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.70 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |