C16H11NO — CID 149297949
8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-14-amine (PubChem CID 149297949) has the molecular formula C16H11NO and a molecular weight of 233.27 g/mol. Its IUPAC name is 8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-14-amine.
| Compound Name | 8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-14-amine |
|---|---|
| PubChem CID | 149297949 |
| Molecular Formula | C16H11NO |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.08 |
| IUPAC Name | 8-oxatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2,4,6,9,11,13,15-octaen-14-amine |
| SMILES | Nc1ccc2c3c(cccc13)Oc1ccccc1-2 |
| InChI | InChI=1S/C16H11NO/c17-13-9-8-11-10-4-1-2-6-14(10)18-15-7-3-5-12(13)16(11)15/h1-9H,17H2 |
| InChIKey | XWEDZRHFRXYGBX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|