C30H39N3O3 — CID 140779000
tert-butyl 3-[2-amino-4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoate (PubChem CID 140779000) has the molecular formula C30H39N3O3 and a molecular weight of 489.66 g/mol. Its IUPAC name is tert-butyl 3-[2-amino-4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoate.
| Compound Name | tert-butyl 3-[2-amino-4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoate |
|---|---|
| PubChem CID | 140779000 |
| Molecular Formula | C30H39N3O3 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | tert-butyl 3-[2-amino-4-[5-(4-heptoxyphenyl)pyrimidin-2-yl]phenyl]propanoate |
| SMILES | CCCCCCCOc1ccc(-c2cnc(-c3ccc(CCC(=O)OC(C)(C)C)c(N)c3)nc2)cc1 |
| InChI | InChI=1S/C30H39N3O3/c1-5-6-7-8-9-18-35-26-15-12-22(13-16-26)25-20-32-29(33-21-25)24-11-10-23(27(31)19-24)14-17-28(34)36-30(2,3)4/h10-13,15-16,19-21H,5-9,14,17-18,31H2,1-4H3 |
| InChIKey | JTJPFHVSZOGOOB-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 87.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|