C34H44N4O3Si — CID 140780250
(3S)-3-(dibenzylamino)-2-phenylmethoxy-N-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]butanamide (PubChem CID 140780250) has the molecular formula C34H44N4O3Si and a molecular weight of 584.84 g/mol. Its IUPAC name is (3S)-3-(dibenzylamino)-2-phenylmethoxy-N-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]butanamide.
| Compound Name | (3S)-3-(dibenzylamino)-2-phenylmethoxy-N-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]butanamide |
|---|---|
| PubChem CID | 140780250 |
| Molecular Formula | C34H44N4O3Si |
| Molecular Weight | 584.84 g/mol |
| Exact Mass | 584.32 |
| IUPAC Name | (3S)-3-(dibenzylamino)-2-phenylmethoxy-N-[1-(2-trimethylsilylethoxymethyl)pyrazol-4-yl]butanamide |
| SMILES | C[C@@H](C(OCc1ccccc1)C(=O)Nc1cnn(COCC[Si](C)(C)C)c1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C34H44N4O3Si/c1-28(37(23-29-14-8-5-9-15-29)24-30-16-10-6-11-17-30)33(41-26-31-18-12-7-13-19-31)34(39)36-32-22-35-38(25-32)27-40-20-21-42(2,3)4/h5-19,22,25,28,33H,20-21,23-24,26-27H2,1-4H3,(H,36,39)/t28-,33?/m0/s1 |
| InChIKey | UEQIULWHEAWXDR-YCIOTGQKSA-N |
| XLogP | 6.81 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.84 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|