C26H21F3N3S- — CID 140780343
4-(2-pentyldibenzothiophen-3-yl)-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine (PubChem CID 140780343) has the molecular formula C26H21F3N3S- and a molecular weight of 464.54 g/mol. Its IUPAC name is 4-(2-pentyldibenzothiophen-3-yl)-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine.
| Compound Name | 4-(2-pentyldibenzothiophen-3-yl)-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
|---|---|
| PubChem CID | 140780343 |
| Molecular Formula | C26H21F3N3S- |
| Molecular Weight | 464.54 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 4-(2-pentyldibenzothiophen-3-yl)-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
| SMILES | CCCCCc1cc2c(cc1-c1ccnc(-c3cc(C(F)(F)F)n[n-]3)c1)sc1ccccc12 |
| InChI | InChI=1S/C26H21F3N3S/c1-2-3-4-7-16-12-20-18-8-5-6-9-23(18)33-24(20)14-19(16)17-10-11-30-21(13-17)22-15-25(32-31-22)26(27,28)29/h5-6,8-15H,2-4,7H2,1H3/q-1 |
| InChIKey | IYBRMYJMELFKEE-UHFFFAOYSA-N |
| XLogP | 7.89 |
| TPSA | 39.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.54 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|