C21H19F3N3S2- — CID 140780381
4-(4-hexylthieno[2,3-b]thiophen-5-yl)-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine (PubChem CID 140780381) has the molecular formula C21H19F3N3S2- and a molecular weight of 434.53 g/mol. Its IUPAC name is 4-(4-hexylthieno[2,3-b]thiophen-5-yl)-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine.
| Compound Name | 4-(4-hexylthieno[2,3-b]thiophen-5-yl)-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
|---|---|
| PubChem CID | 140780381 |
| Molecular Formula | C21H19F3N3S2- |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.10 |
| IUPAC Name | 4-(4-hexylthieno[2,3-b]thiophen-5-yl)-2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
| SMILES | CCCCCCc1c(-c2ccnc(-c3cc(C(F)(F)F)n[n-]3)c2)sc2sccc12 |
| InChI | InChI=1S/C21H19F3N3S2/c1-2-3-4-5-6-14-15-8-10-28-20(15)29-19(14)13-7-9-25-16(11-13)17-12-18(27-26-17)21(22,23)24/h7-12H,2-6H2,1H3/q-1 |
| InChIKey | ASCSTAVJDKTYRP-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 39.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|