C25H21F6N5S-2 — CID 140780443
4-[(E)-2-(5-hexylthiophen-2-yl)ethenyl]-2,6-bis[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine (PubChem CID 140780443) has the molecular formula C25H21F6N5S-2 and a molecular weight of 537.53 g/mol. Its IUPAC name is 4-[(E)-2-(5-hexylthiophen-2-yl)ethenyl]-2,6-bis[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine.
| Compound Name | 4-[(E)-2-(5-hexylthiophen-2-yl)ethenyl]-2,6-bis[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
|---|---|
| PubChem CID | 140780443 |
| Molecular Formula | C25H21F6N5S-2 |
| Molecular Weight | 537.53 g/mol |
| Exact Mass | 537.14 |
| IUPAC Name | 4-[(E)-2-(5-hexylthiophen-2-yl)ethenyl]-2,6-bis[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
| SMILES | CCCCCCc1ccc(/C=C/c2cc(-c3cc(C(F)(F)F)n[n-]3)nc(-c3cc(C(F)(F)F)n[n-]3)c2)s1 |
| InChI | InChI=1S/C25H21F6N5S/c1-2-3-4-5-6-16-9-10-17(37-16)8-7-15-11-18(20-13-22(35-33-20)24(26,27)28)32-19(12-15)21-14-23(36-34-21)25(29,30)31/h7-14H,2-6H2,1H3/q-2/b8-7+ |
| InChIKey | FYHRLEFKTZLGHI-BQYQJAHWSA-N |
| XLogP | 7.51 |
| TPSA | 66.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.53 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|