C22H30F3N3O3Si — CID 140781143
(3S)-N-[1-(4,4-difluorocyclohexyl)-2-(3-fluoro-4-trimethylsilylanilino)-2-oxoethyl]-5-oxopyrrolidine-3-carboxamide (PubChem CID 140781143) has the molecular formula C22H30F3N3O3Si and a molecular weight of 469.58 g/mol. Its IUPAC name is (3S)-N-[1-(4,4-difluorocyclohexyl)-2-(3-fluoro-4-trimethylsilylanilino)-2-oxoethyl]-5-oxopyrrolidine-3-carboxamide.
| Compound Name | (3S)-N-[1-(4,4-difluorocyclohexyl)-2-(3-fluoro-4-trimethylsilylanilino)-2-oxoethyl]-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 140781143 |
| Molecular Formula | C22H30F3N3O3Si |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.20 |
| IUPAC Name | (3S)-N-[1-(4,4-difluorocyclohexyl)-2-(3-fluoro-4-trimethylsilylanilino)-2-oxoethyl]-5-oxopyrrolidine-3-carboxamide |
| SMILES | C[Si](C)(C)c1ccc(NC(=O)C(NC(=O)[C@@H]2CNC(=O)C2)C2CCC(F)(F)CC2)cc1F |
| InChI | InChI=1S/C22H30F3N3O3Si/c1-32(2,3)17-5-4-15(11-16(17)23)27-21(31)19(13-6-8-22(24,25)9-7-13)28-20(30)14-10-18(29)26-12-14/h4-5,11,13-14,19H,6-10,12H2,1-3H3,(H,26,29)(H,27,31)(H,28,30)/t14-,19?/m0/s1 |
| InChIKey | RXMZANQOVRGQBY-KTQQKIMGSA-N |
| XLogP | 2.76 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|