C23H30F3N3O4 — CID 121316748
(Z)-N'-[(1R)-2-(4-tert-butyl-3-fluoroanilino)-1-(4,4-difluorocyclohexyl)-2-oxoethyl]-3-hydroxypent-2-enediamide (PubChem CID 121316748) has the molecular formula C23H30F3N3O4 and a molecular weight of 469.50 g/mol. Its IUPAC name is (Z)-N'-[(1R)-2-(4-tert-butyl-3-fluoroanilino)-1-(4,4-difluorocyclohexyl)-2-oxoethyl]-3-hydroxypent-2-enediamide.
| Compound Name | (Z)-N'-[(1R)-2-(4-tert-butyl-3-fluoroanilino)-1-(4,4-difluorocyclohexyl)-2-oxoethyl]-3-hydroxypent-2-enediamide |
|---|---|
| PubChem CID | 121316748 |
| Molecular Formula | C23H30F3N3O4 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.22 |
| IUPAC Name | (Z)-N'-[(1R)-2-(4-tert-butyl-3-fluoroanilino)-1-(4,4-difluorocyclohexyl)-2-oxoethyl]-3-hydroxypent-2-enediamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)[C@H](NC(=O)C/C(O)=C/C(N)=O)C2CCC(F)(F)CC2)cc1F |
| InChI | InChI=1S/C23H30F3N3O4/c1-22(2,3)16-5-4-14(10-17(16)24)28-21(33)20(13-6-8-23(25,26)9-7-13)29-19(32)12-15(30)11-18(27)31/h4-5,10-11,13,20,30H,6-9,12H2,1-3H3,(H2,27,31)(H,28,33)(H,29,32)/b15-11-/t20-/m1/s1 |
| InChIKey | FJTZODDEGUQNAD-UMDONVSZSA-N |
| XLogP | 3.69 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|