C18H25FN3O3S- — CID 126634036
(2R)-2-[(1-amino-2-methylpropylidene)amino]-2-[2-fluoro-5-[(1-methylcyclopropanecarbonyl)amino]phenyl]propane-1-sulfinate (PubChem CID 126634036) has the molecular formula C18H25FN3O3S- and a molecular weight of 382.48 g/mol. Its IUPAC name is (2R)-2-[(1-amino-2-methylpropylidene)amino]-2-[2-fluoro-5-[(1-methylcyclopropanecarbonyl)amino]phenyl]propane-1-sulfinate.
| Compound Name | (2R)-2-[(1-amino-2-methylpropylidene)amino]-2-[2-fluoro-5-[(1-methylcyclopropanecarbonyl)amino]phenyl]propane-1-sulfinate |
|---|---|
| PubChem CID | 126634036 |
| Molecular Formula | C18H25FN3O3S- |
| Molecular Weight | 382.48 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | (2R)-2-[(1-amino-2-methylpropylidene)amino]-2-[2-fluoro-5-[(1-methylcyclopropanecarbonyl)amino]phenyl]propane-1-sulfinate |
| SMILES | CC(C)/C(N)=N\[C@@](C)(CS(=O)[O-])c1cc(NC(=O)C2(C)CC2)ccc1F |
| InChI | InChI=1S/C18H26FN3O3S/c1-11(2)15(20)22-18(4,10-26(24)25)13-9-12(5-6-14(13)19)21-16(23)17(3)7-8-17/h5-6,9,11H,7-8,10H2,1-4H3,(H2,20,22)(H,21,23)(H,24,25)/p-1/t18-/m0/s1 |
| InChIKey | NRULGOPODGAMBW-SFHVURJKSA-M |
| XLogP | 2.67 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.48 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|