C12H13F2N3O2 — CID 80590768
N-(3,4-difluorophenyl)-1-[(E)-N'-hydroxycarbamimidoyl]cyclobutane-1-carboxamide (PubChem CID 80590768) has the molecular formula C12H13F2N3O2 and a molecular weight of 269.25 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-1-[(E)-N'-hydroxycarbamimidoyl]cyclobutane-1-carboxamide.
| Compound Name | N-(3,4-difluorophenyl)-1-[(E)-N'-hydroxycarbamimidoyl]cyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 80590768 |
| Molecular Formula | C12H13F2N3O2 |
| Molecular Weight | 269.25 g/mol |
| Exact Mass | 269.10 |
| IUPAC Name | N-(3,4-difluorophenyl)-1-[(E)-N'-hydroxycarbamimidoyl]cyclobutane-1-carboxamide |
| SMILES | N/C(=N/O)C1(C(=O)Nc2ccc(F)c(F)c2)CCC1 |
| InChI | InChI=1S/C12H13F2N3O2/c13-8-3-2-7(6-9(8)14)16-11(18)12(4-1-5-12)10(15)17-19/h2-3,6,19H,1,4-5H2,(H2,15,17)(H,16,18) |
| InChIKey | SRQSBKZIVHHXPO-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.25 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|