C12H15N3O2 — CID 80590428
1-[(E)-N'-hydroxycarbamimidoyl]-N-phenylcyclobutane-1-carboxamide (PubChem CID 80590428) has the molecular formula C12H15N3O2 and a molecular weight of 233.27 g/mol. Its IUPAC name is 1-[(E)-N'-hydroxycarbamimidoyl]-N-phenylcyclobutane-1-carboxamide.
| Compound Name | 1-[(E)-N'-hydroxycarbamimidoyl]-N-phenylcyclobutane-1-carboxamide |
|---|---|
| PubChem CID | 80590428 |
| Molecular Formula | C12H15N3O2 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-[(E)-N'-hydroxycarbamimidoyl]-N-phenylcyclobutane-1-carboxamide |
| SMILES | N/C(=N/O)C1(C(=O)Nc2ccccc2)CCC1 |
| InChI | InChI=1S/C12H15N3O2/c13-10(15-17)12(7-4-8-12)11(16)14-9-5-2-1-3-6-9/h1-3,5-6,17H,4,7-8H2,(H2,13,15)(H,14,16) |
| InChIKey | OIXBHCBOYCJBHO-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|