C17H19BN2O2 — CID 140781931
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]quinoline (PubChem CID 140781931) has the molecular formula C17H19BN2O2 and a molecular weight of 294.16 g/mol. Its IUPAC name is 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]quinoline.
| Compound Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]quinoline |
|---|---|
| PubChem CID | 140781931 |
| Molecular Formula | C17H19BN2O2 |
| Molecular Weight | 294.16 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazolo[1,5-a]quinoline |
| SMILES | CC1(C)OB(c2cc3ccc4ccccc4n3n2)OC1(C)C |
| InChI | InChI=1S/C17H19BN2O2/c1-16(2)17(3,4)22-18(21-16)15-11-13-10-9-12-7-5-6-8-14(12)20(13)19-15/h5-11H,1-4H3 |
| InChIKey | LLOJXIQZKFECRA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 35.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.16 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|